C23H25BrClN3O — CID 50869011
2-bromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50869011) has the molecular formula C23H25BrClN3O and a molecular weight of 474.83 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50869011 |
| Molecular Formula | C23H25BrClN3O |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2-bromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2cc(Cl)c(/C=N\NC(=O)c3ccccc3Br)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H25BrClN3O/c1-5-10-28-21-12-20(25)16(11-18(21)15(2)13-23(28,3)4)14-26-27-22(29)17-8-6-7-9-19(17)24/h6-9,11-14H,5,10H2,1-4H3,(H,27,29)/b26-14- |
| InChIKey | ORWQECQMYATMDF-WGARJPEWSA-N |
| XLogP | 6.28 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|