C22H24BrN3O — CID 133170826
2-bromo-N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 133170826) has the molecular formula C22H24BrN3O and a molecular weight of 426.36 g/mol. Its IUPAC name is 2-bromo-N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133170826 |
| Molecular Formula | C22H24BrN3O |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-bromo-N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCN1c2ccc(/C=N/NC(=O)c3ccccc3Br)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H24BrN3O/c1-5-26-20-11-10-16(12-18(20)15(2)13-22(26,3)4)14-24-25-21(27)17-8-6-7-9-19(17)23/h6-14H,5H2,1-4H3,(H,25,27)/b24-14+ |
| InChIKey | QTWZIRPYTODNCF-ZVHZXABRSA-N |
| XLogP | 5.23 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|