C27H29N3O2 — CID 50866069
N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide (PubChem CID 50866069) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide.
| Compound Name | N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide |
|---|---|
| PubChem CID | 50866069 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[(E)-(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide |
| SMILES | CCN1c2ccc(/C=N/NC(=O)COc3cccc4ccccc34)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H29N3O2/c1-5-30-24-14-13-20(15-23(24)19(2)16-27(30,3)4)17-28-29-26(31)18-32-25-12-8-10-21-9-6-7-11-22(21)25/h6-17H,5,18H2,1-4H3,(H,29,31)/b28-17+ |
| InChIKey | ILYCSANAYWAKOX-OGLMXYFKSA-N |
| XLogP | 5.39 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|