C27H28ClN3O2 — CID 50866834
N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide (PubChem CID 50866834) has the molecular formula C27H28ClN3O2 and a molecular weight of 461.99 g/mol. Its IUPAC name is N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide.
| Compound Name | N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide |
|---|---|
| PubChem CID | 50866834 |
| Molecular Formula | C27H28ClN3O2 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-[(E)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-yloxyacetamide |
| SMILES | CCN1c2cc(Cl)c(/C=N/NC(=O)COc3cccc4ccccc34)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C27H28ClN3O2/c1-5-31-24-14-23(28)20(13-22(24)18(2)15-27(31,3)4)16-29-30-26(32)17-33-25-12-8-10-19-9-6-7-11-21(19)25/h6-16H,5,17H2,1-4H3,(H,30,32)/b29-16+ |
| InChIKey | UVQNTCVHLCSGPG-MUFRIFMGSA-N |
| XLogP | 6.04 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|