C30H33N3O2 — CID 50866777
N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-(4-phenylphenoxy)acetamide (PubChem CID 50866777) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 50866777 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-[(E)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-(4-phenylphenoxy)acetamide |
| SMILES | CCN1c2cc(C)c(/C=N/NC(=O)COc3ccc(-c4ccccc4)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C30H33N3O2/c1-6-33-28-16-21(2)25(17-27(28)22(3)18-30(33,4)5)19-31-32-29(34)20-35-26-14-12-24(13-15-26)23-10-8-7-9-11-23/h7-19H,6,20H2,1-5H3,(H,32,34)/b31-19+ |
| InChIKey | MYJANSGFQDLHRH-ZCTHSVRISA-N |
| XLogP | 6.21 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|