C24H28ClN3O3 — CID 50867784
2-(2-chlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50867784) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50867784 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CCN1c2cc(OC)c(/C=N/NC(=O)COc3ccccc3Cl)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H28ClN3O3/c1-6-28-20-12-22(30-5)17(11-18(20)16(2)13-24(28,3)4)14-26-27-23(29)15-31-21-10-8-7-9-19(21)25/h7-14H,6,15H2,1-5H3,(H,27,29)/b26-14+ |
| InChIKey | IVESYRVYGUJORT-VULFUBBASA-N |
| XLogP | 4.90 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|