C24H27Cl2N3O3 — CID 50867736
2-(2,4-dichlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50867736) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50867736 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(E)-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CCN1c2cc(OC)c(/C=N/NC(=O)COc3ccc(Cl)cc3Cl)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H27Cl2N3O3/c1-6-29-20-11-22(31-5)16(9-18(20)15(2)12-24(29,3)4)13-27-28-23(30)14-32-21-8-7-17(25)10-19(21)26/h7-13H,6,14H2,1-5H3,(H,28,30)/b27-13+ |
| InChIKey | NQMTYQMCSOZKBG-UVHMKAGCSA-N |
| XLogP | 5.55 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|