C28H31N3O — CID 50866711
N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 50866711) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 50866711 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | CCN1c2cc(C)c(/C=N\NC(=O)Cc3cccc4ccccc34)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C28H31N3O/c1-6-31-26-14-19(2)23(15-25(26)20(3)17-28(31,4)5)18-29-30-27(32)16-22-12-9-11-21-10-7-8-13-24(21)22/h7-15,17-18H,6,16H2,1-5H3,(H,30,32)/b29-18- |
| InChIKey | ORRWOTXIQPBPQI-MIXAMLLLSA-N |
| XLogP | 5.86 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|