C26H34N4O — CID 50866774
2-(3,4-dimethylanilino)-N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50866774) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethylanilino)-N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50866774 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-(3,4-dimethylanilino)-N-[(Z)-(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CCN1c2cc(C)c(/C=N\NC(=O)CNc3ccc(C)c(C)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H34N4O/c1-8-30-24-12-19(4)21(13-23(24)20(5)14-26(30,6)7)15-28-29-25(31)16-27-22-10-9-17(2)18(3)11-22/h9-15,27H,8,16H2,1-7H3,(H,29,31)/b28-15- |
| InChIKey | MEIIILZSYWDAEH-MBTHVWNTSA-N |
| XLogP | 5.20 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|