C23H26N2O2 — CID 50866984
3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]benzoic acid (PubChem CID 50866984) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]benzoic acid.
| Compound Name | 3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 50866984 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-[(1-ethyl-2,2,4,7-tetramethylquinolin-6-yl)methylideneamino]benzoic acid |
| SMILES | CCN1c2cc(C)c(/C=N/c3cccc(C(=O)O)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H26N2O2/c1-6-25-21-10-15(2)18(12-20(21)16(3)13-23(25,4)5)14-24-19-9-7-8-17(11-19)22(26)27/h7-14H,6H2,1-5H3,(H,26,27)/b24-14+ |
| InChIKey | IXTGYWPLFJMROA-ZVHZXABRSA-N |
| XLogP | 5.47 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|