C22H23FN2O2 — CID 50867552
4-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoic acid (PubChem CID 50867552) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoic acid.
| Compound Name | 4-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 50867552 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 4-[(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methylideneamino]benzoic acid |
| SMILES | CCN1c2cc(F)c(/C=N/c3ccc(C(=O)O)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H23FN2O2/c1-5-25-20-11-19(23)16(10-18(20)14(2)12-22(25,3)4)13-24-17-8-6-15(7-9-17)21(26)27/h6-13H,5H2,1-4H3,(H,26,27)/b24-13+ |
| InChIKey | JPJBOOARBVRHFW-ZMOGYAJESA-N |
| XLogP | 5.30 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|