C21H21Cl2FN2 — CID 50867579
N-(2,4-dichlorophenyl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine (PubChem CID 50867579) has the molecular formula C21H21Cl2FN2 and a molecular weight of 391.32 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine.
| Compound Name | N-(2,4-dichlorophenyl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50867579 |
| Molecular Formula | C21H21Cl2FN2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-(1-ethyl-7-fluoro-2,2,4-trimethylquinolin-6-yl)methanimine |
| SMILES | CCN1c2cc(F)c(/C=N/c3ccc(Cl)cc3Cl)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C21H21Cl2FN2/c1-5-26-20-10-18(24)14(8-16(20)13(2)11-21(26,3)4)12-25-19-7-6-15(22)9-17(19)23/h6-12H,5H2,1-4H3/b25-12+ |
| InChIKey | XBHFZVQHLOLHOF-BRJLIKDPSA-N |
| XLogP | 6.90 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|