C22H25ClN2 — CID 50867062
1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(2-methylphenyl)methanimine (PubChem CID 50867062) has the molecular formula C22H25ClN2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(2-methylphenyl)methanimine.
| Compound Name | 1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 50867062 |
| Molecular Formula | C22H25ClN2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(2-methylphenyl)methanimine |
| SMILES | CCN1c2cc(Cl)c(/C=N/c3ccccc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H25ClN2/c1-6-25-21-12-19(23)17(11-18(21)16(3)13-22(25,4)5)14-24-20-10-8-7-9-15(20)2/h7-14H,6H2,1-5H3/b24-14+ |
| InChIKey | MXIYARRGHOPPGR-ZVHZXABRSA-N |
| XLogP | 6.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|