C20H19Cl3N2 — CID 50865494
1-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2,3-dichlorophenyl)methanimine (PubChem CID 50865494) has the molecular formula C20H19Cl3N2 and a molecular weight of 393.75 g/mol. Its IUPAC name is 1-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2,3-dichlorophenyl)methanimine.
| Compound Name | 1-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2,3-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 50865494 |
| Molecular Formula | C20H19Cl3N2 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2,3-dichlorophenyl)methanimine |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=N/c3cccc(Cl)c3Cl)cc21 |
| InChI | InChI=1S/C20H19Cl3N2/c1-12-10-20(2,3)25(4)18-9-16(22)13(8-14(12)18)11-24-17-7-5-6-15(21)19(17)23/h5-11H,1-4H3/b24-11+ |
| InChIKey | WBASGRBWWDJQHF-BHGWPJFGSA-N |
| XLogP | 7.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|