C22H25FN2O — CID 50865423
N-(2-ethoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine (PubChem CID 50865423) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine.
| Compound Name | N-(2-ethoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50865423 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-(2-ethoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
| SMILES | CCOc1ccccc1/N=C/c1cc2c(cc1F)N(C)C(C)(C)C=C2C |
| InChI | InChI=1S/C22H25FN2O/c1-6-26-21-10-8-7-9-19(21)24-14-16-11-17-15(2)13-22(3,4)25(5)20(17)12-18(16)23/h7-14H,6H2,1-5H3/b24-14+ |
| InChIKey | UQBMFAGVKQHSPG-ZVHZXABRSA-N |
| XLogP | 5.61 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|