C21H22BrFN2 — CID 50865605
N-(4-bromo-2-methylphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine (PubChem CID 50865605) has the molecular formula C21H22BrFN2 and a molecular weight of 401.32 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine.
| Compound Name | N-(4-bromo-2-methylphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50865605 |
| Molecular Formula | C21H22BrFN2 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
| SMILES | CC1=CC(C)(C)N(C)c2cc(F)c(/C=N/c3ccc(Br)cc3C)cc21 |
| InChI | InChI=1S/C21H22BrFN2/c1-13-8-16(22)6-7-19(13)24-12-15-9-17-14(2)11-21(3,4)25(5)20(17)10-18(15)23/h6-12H,1-5H3/b24-12+ |
| InChIKey | STKBZMQXAYPWGA-WYMPLXKRSA-N |
| XLogP | 6.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|