C21H22FN3O2 — CID 50865470
1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine (PubChem CID 50865470) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine.
| Compound Name | 1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 50865470 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine |
| SMILES | CC1=CC(C)(C)N(C)c2cc(F)c(/C=N/c3ccc([N+](=O)[O-])cc3C)cc21 |
| InChI | InChI=1S/C21H22FN3O2/c1-13-8-16(25(26)27)6-7-19(13)23-12-15-9-17-14(2)11-21(3,4)24(5)20(17)10-18(15)22/h6-12H,1-5H3/b23-12+ |
| InChIKey | MCRWATJASLPHNY-FSJBWODESA-N |
| XLogP | 5.42 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|