C20H21ClN4O2 — CID 50864772
N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-4-nitroaniline (PubChem CID 50864772) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-4-nitroaniline.
| Compound Name | N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 50864772 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-4-nitroaniline |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=N\Nc3ccc([N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C20H21ClN4O2/c1-13-11-20(2,3)24(4)19-10-18(21)14(9-17(13)19)12-22-23-15-5-7-16(8-6-15)25(26)27/h5-12,23H,1-4H3/b22-12- |
| InChIKey | CMNYDCSCXBVYCX-UUYOSTAYSA-N |
| XLogP | 5.33 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|