C21H22ClN3O2 — CID 50864865
4-[(2E)-2-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]hydrazinyl]benzoic acid (PubChem CID 50864865) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-[(2E)-2-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[(2E)-2-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 50864865 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-[(2E)-2-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]hydrazinyl]benzoic acid |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=N/Nc3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C21H22ClN3O2/c1-13-11-21(2,3)25(4)19-10-18(22)15(9-17(13)19)12-23-24-16-7-5-14(6-8-16)20(26)27/h5-12,24H,1-4H3,(H,26,27)/b23-12+ |
| InChIKey | KRQDANOGYOYCPQ-FSJBWODESA-N |
| XLogP | 5.12 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|