C22H26ClN3 — CID 50868938
N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]aniline (PubChem CID 50868938) has the molecular formula C22H26ClN3 and a molecular weight of 367.92 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]aniline.
| Compound Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50868938 |
| Molecular Formula | C22H26ClN3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]aniline |
| SMILES | CCCN1c2cc(Cl)c(/C=N\Nc3ccccc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H26ClN3/c1-5-11-26-21-13-20(23)17(12-19(21)16(2)14-22(26,3)4)15-24-25-18-9-7-6-8-10-18/h6-10,12-15,25H,5,11H2,1-4H3/b24-15- |
| InChIKey | WIHVTCXUYXREEN-IWIPYMOSSA-N |
| XLogP | 6.20 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|