C23H28N2O — CID 50869657
1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylmethanimine (PubChem CID 50869657) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylmethanimine.
| Compound Name | 1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylmethanimine |
|---|---|
| PubChem CID | 50869657 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)-N-phenylmethanimine |
| SMILES | CCCN1c2cc(OC)c(/C=N/c3ccccc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H28N2O/c1-6-12-25-21-14-22(26-5)18(16-24-19-10-8-7-9-11-19)13-20(21)17(2)15-23(25,3)4/h7-11,13-16H,6,12H2,1-5H3/b24-16+ |
| InChIKey | AMBBBZWDXWWHHZ-LFVJCYFKSA-N |
| XLogP | 5.86 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|