C24H27N3O — CID 50869589
4-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzonitrile (PubChem CID 50869589) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzonitrile.
| Compound Name | 4-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzonitrile |
|---|---|
| PubChem CID | 50869589 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 4-[(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]benzonitrile |
| SMILES | CCCN1c2cc(OC)c(/C=N/c3ccc(C#N)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H27N3O/c1-6-11-27-22-13-23(28-5)19(12-21(22)17(2)14-24(27,3)4)16-26-20-9-7-18(15-25)8-10-20/h7-10,12-14,16H,6,11H2,1-5H3/b26-16+ |
| InChIKey | RYQGQTQZCGIQOF-WGOQTCKBSA-N |
| XLogP | 5.73 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|