C24H29BrN2O — CID 50870031
N-(4-bromo-2-methylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50870031) has the molecular formula C24H29BrN2O and a molecular weight of 441.41 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-(4-bromo-2-methylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50870031 |
| Molecular Formula | C24H29BrN2O |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCN1c2cc(OC)c(/C=N/c3ccc(Br)cc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H29BrN2O/c1-7-10-27-22-13-23(28-6)18(12-20(22)17(3)14-24(27,4)5)15-26-21-9-8-19(25)11-16(21)2/h8-9,11-15H,7,10H2,1-6H3/b26-15+ |
| InChIKey | GSNWBPDBUNJLRG-CVKSISIWSA-N |
| XLogP | 6.93 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|