C22H25BrN2O — CID 50868279
N-(3-bromophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine (PubChem CID 50868279) has the molecular formula C22H25BrN2O and a molecular weight of 413.36 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine.
| Compound Name | N-(3-bromophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50868279 |
| Molecular Formula | C22H25BrN2O |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-(3-bromophenyl)-1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methanimine |
| SMILES | CCN1c2cc(OC)c(/C=N/c3cccc(Br)c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H25BrN2O/c1-6-25-20-12-21(26-5)16(10-19(20)15(2)13-22(25,3)4)14-24-18-9-7-8-17(23)11-18/h7-14H,6H2,1-5H3/b24-14+ |
| InChIKey | YCIMOCFAHKNLSC-ZVHZXABRSA-N |
| XLogP | 6.23 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|