C24H29N3O2 — CID 50868239
N-[4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenyl]acetamide (PubChem CID 50868239) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenyl]acetamide.
| Compound Name | N-[4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenyl]acetamide |
|---|---|
| PubChem CID | 50868239 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[4-[(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)methylideneamino]phenyl]acetamide |
| SMILES | CCN1c2cc(OC)c(/C=N/c3ccc(NC(C)=O)cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C24H29N3O2/c1-7-27-22-13-23(29-6)18(12-21(22)16(2)14-24(27,4)5)15-25-19-8-10-20(11-9-19)26-17(3)28/h8-15H,7H2,1-6H3,(H,26,28)/b25-15+ |
| InChIKey | OAGLCIVOVODKDL-MFKUBSTISA-N |
| XLogP | 5.43 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|