C27H36N2O — CID 50869674
N-(4-butylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine (PubChem CID 50869674) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is N-(4-butylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine.
| Compound Name | N-(4-butylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50869674 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | N-(4-butylphenyl)-1-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methanimine |
| SMILES | CCCCc1ccc(/N=C/c2cc3c(cc2OC)N(CCC)C(C)(C)C=C3C)cc1 |
| InChI | InChI=1S/C27H36N2O/c1-7-9-10-21-11-13-23(14-12-21)28-19-22-16-24-20(3)18-27(4,5)29(15-8-2)25(24)17-26(22)30-6/h11-14,16-19H,7-10,15H2,1-6H3/b28-19+ |
| InChIKey | LAJBDTLFSMVKGF-TURZUDJPSA-N |
| XLogP | 7.20 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|