C21H23ClN2O — CID 50866237
N-(4-chlorophenyl)-1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methanimine (PubChem CID 50866237) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methanimine.
| Compound Name | N-(4-chlorophenyl)-1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50866237 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(4-chlorophenyl)-1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
| SMILES | COc1cc2c(cc1/C=N/c1ccc(Cl)cc1)C(C)=CC(C)(C)N2C |
| InChI | InChI=1S/C21H23ClN2O/c1-14-12-21(2,3)24(4)19-11-20(25-5)15(10-18(14)19)13-23-17-8-6-16(22)7-9-17/h6-13H,1-5H3/b23-13+ |
| InChIKey | GSFFDEQJDVSARU-YDZHTSKRSA-N |
| XLogP | 5.73 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|