C21H22ClFN2O — CID 50865263
N-(3-chloro-4-methoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine (PubChem CID 50865263) has the molecular formula C21H22ClFN2O and a molecular weight of 372.87 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50865263 |
| Molecular Formula | C21H22ClFN2O |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
| SMILES | COc1ccc(/N=C/c2cc3c(cc2F)N(C)C(C)(C)C=C3C)cc1Cl |
| InChI | InChI=1S/C21H22ClFN2O/c1-13-11-21(2,3)25(4)19-10-18(23)14(8-16(13)19)12-24-15-6-7-20(26-5)17(22)9-15/h6-12H,1-5H3/b24-12+ |
| InChIKey | RAKBQIZCTYTDRM-WYMPLXKRSA-N |
| XLogP | 5.87 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|