C23H25FN2O2 — CID 50865385
ethyl 4-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzoate (PubChem CID 50865385) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is ethyl 4-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzoate.
| Compound Name | ethyl 4-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 50865385 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | ethyl 4-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2cc3c(cc2F)N(C)C(C)(C)C=C3C)cc1 |
| InChI | InChI=1S/C23H25FN2O2/c1-6-28-22(27)16-7-9-18(10-8-16)25-14-17-11-19-15(2)13-23(3,4)26(5)21(19)12-20(17)24/h7-14H,6H2,1-5H3/b25-14+ |
| InChIKey | CFMXJCZBLJTBMY-AFUMVMLFSA-N |
| XLogP | 5.38 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|