C20H19Cl2FN2 — CID 50865569
N-(3,4-dichlorophenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine (PubChem CID 50865569) has the molecular formula C20H19Cl2FN2 and a molecular weight of 377.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine.
| Compound Name | N-(3,4-dichlorophenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50865569 |
| Molecular Formula | C20H19Cl2FN2 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methanimine |
| SMILES | CC1=CC(C)(C)N(C)c2cc(F)c(/C=N/c3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C20H19Cl2FN2/c1-12-10-20(2,3)25(4)19-9-18(23)13(7-15(12)19)11-24-14-5-6-16(21)17(22)8-14/h5-11H,1-4H3/b24-11+ |
| InChIKey | XAEVOBGWKVRMSY-BHGWPJFGSA-N |
| XLogP | 6.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|