C21H24N2O — CID 50865599
1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-phenylmethanimine (PubChem CID 50865599) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-phenylmethanimine.
| Compound Name | 1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-phenylmethanimine |
|---|---|
| PubChem CID | 50865599 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-phenylmethanimine |
| SMILES | COc1cc2c(cc1/C=N/c1ccccc1)C(C)=CC(C)(C)N2C |
| InChI | InChI=1S/C21H24N2O/c1-15-13-21(2,3)23(4)19-12-20(24-5)16(11-18(15)19)14-22-17-9-7-6-8-10-17/h6-14H,1-5H3/b22-14+ |
| InChIKey | WHOYTSYLNXFQRJ-HYARGMPZSA-N |
| XLogP | 5.08 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|