C24H30N2O — CID 50866206
1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-(4-propan-2-ylphenyl)methanimine (PubChem CID 50866206) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-(4-propan-2-ylphenyl)methanimine.
| Compound Name | 1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-(4-propan-2-ylphenyl)methanimine |
|---|---|
| PubChem CID | 50866206 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)-N-(4-propan-2-ylphenyl)methanimine |
| SMILES | COc1cc2c(cc1/C=N/c1ccc(C(C)C)cc1)C(C)=CC(C)(C)N2C |
| InChI | InChI=1S/C24H30N2O/c1-16(2)18-8-10-20(11-9-18)25-15-19-12-21-17(3)14-24(4,5)26(6)22(21)13-23(19)27-7/h8-16H,1-7H3/b25-15+ |
| InChIKey | JUPCKJPGZHDIHF-MFKUBSTISA-N |
| XLogP | 6.20 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|