C23H29N3 — CID 50864744
N,N-dimethyl-4-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline (PubChem CID 50864744) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline.
| Compound Name | N,N-dimethyl-4-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50864744 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | N,N-dimethyl-4-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=N/c3ccc(N(C)C)cc3)cc21 |
| InChI | InChI=1S/C23H29N3/c1-16-12-22-21(17(2)14-23(3,4)26(22)7)13-18(16)15-24-19-8-10-20(11-9-19)25(5)6/h8-15H,1-7H3/b24-15+ |
| InChIKey | MGOUVWNPQCEACH-BUVRLJJBSA-N |
| XLogP | 5.44 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|