C23H27N3O3 — CID 50867566
1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine (PubChem CID 50867566) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine.
| Compound Name | 1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 50867566 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-(1-ethyl-7-methoxy-2,2,4-trimethylquinolin-6-yl)-N-(2-methyl-4-nitrophenyl)methanimine |
| SMILES | CCN1c2cc(OC)c(/C=N/c3ccc([N+](=O)[O-])cc3C)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H27N3O3/c1-7-25-21-12-22(29-6)17(11-19(21)16(3)13-23(25,4)5)14-24-20-9-8-18(26(27)28)10-15(20)2/h8-14H,7H2,1-6H3/b24-14+ |
| InChIKey | NQDIKRKXLNYYPK-ZVHZXABRSA-N |
| XLogP | 5.68 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|