C21H22ClN3O2 — CID 50867269
1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-nitrophenyl)methanimine (PubChem CID 50867269) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-nitrophenyl)methanimine.
| Compound Name | 1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 50867269 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)-N-(3-nitrophenyl)methanimine |
| SMILES | CCN1c2cc(Cl)c(/C=N/c3cccc([N+](=O)[O-])c3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C21H22ClN3O2/c1-5-24-20-11-19(22)15(9-18(20)14(2)12-21(24,3)4)13-23-16-7-6-8-17(10-16)25(26)27/h6-13H,5H2,1-4H3/b23-13+ |
| InChIKey | ZLZYDFMYNOQTAO-YDZHTSKRSA-N |
| XLogP | 6.02 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|