C22H23ClN4O3 — CID 50866862
N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide (PubChem CID 50866862) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 50866862 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-4-nitrobenzamide |
| SMILES | CCN1c2cc(Cl)c(/C=N\NC(=O)c3ccc([N+](=O)[O-])cc3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H23ClN4O3/c1-5-26-20-11-19(23)16(10-18(20)14(2)12-22(26,3)4)13-24-25-21(28)15-6-8-17(9-7-15)27(29)30/h6-13H,5H2,1-4H3,(H,25,28)/b24-13- |
| InChIKey | QECGGHCFAJBQKG-CFRMEGHHSA-N |
| XLogP | 5.03 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|