C23H28ClN5OS — CID 50866866
N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 50866866) has the molecular formula C23H28ClN5OS and a molecular weight of 458.03 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 50866866 |
| Molecular Formula | C23H28ClN5OS |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[(Z)-(7-chloro-1-ethyl-2,2,4-trimethylquinolin-6-yl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | CCN1c2cc(Cl)c(/C=N\NC(=O)CSc3nc(C)cc(C)n3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H28ClN5OS/c1-7-29-20-10-19(24)17(9-18(20)14(2)11-23(29,5)6)12-25-28-21(30)13-31-22-26-15(3)8-16(4)27-22/h8-12H,7,13H2,1-6H3,(H,28,30)/b25-12- |
| InChIKey | MNPKOEXKSGCVDM-ROTLSHHCSA-N |
| XLogP | 5.01 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|