C23H23ClN4OS2 — CID 50864905
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]acetamide (PubChem CID 50864905) has the molecular formula C23H23ClN4OS2 and a molecular weight of 471.05 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50864905 |
| Molecular Formula | C23H23ClN4OS2 |
| Molecular Weight | 471.05 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=N/NC(=O)CSc3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C23H23ClN4OS2/c1-14-11-23(2,3)28(4)19-10-17(24)15(9-16(14)19)12-25-27-21(29)13-30-22-26-18-7-5-6-8-20(18)31-22/h5-12H,13H2,1-4H3,(H,27,29)/b25-12+ |
| InChIKey | ZGAZWHCANPLOCO-BRJLIKDPSA-N |
| XLogP | 5.82 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.05 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|