C16H11N4O4S2- — CID 6996693
2-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 6996693) has the molecular formula C16H11N4O4S2- and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 6996693 |
| Molecular Formula | C16H11N4O4S2- |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-[[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | O=C(CSc1nc2ccccc2s1)NN=Cc1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C16H12N4O4S2/c21-13-6-5-11(20(23)24)7-10(13)8-17-19-15(22)9-25-16-18-12-3-1-2-4-14(12)26-16/h1-8,21H,9H2,(H,19,22)/p-1 |
| InChIKey | YWIGBFIQRUMQMD-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|