C17H12N3O3S2- — CID 6863562
2-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 6863562) has the molecular formula C17H12N3O3S2- and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 2-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6863562 |
| Molecular Formula | C17H12N3O3S2- |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C/c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C17H13N3O3S2/c21-15(10-24-17-19-13-7-3-4-8-14(13)25-17)20-18-9-11-5-1-2-6-12(11)16(22)23/h1-9H,10H2,(H,20,21)(H,22,23)/p-1/b18-9+ |
| InChIKey | JHJSSQFJTFBLCX-GIJQJNRQSA-M |
| XLogP | 1.90 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|