C19H15N5OS2 — CID 136842706
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide (PubChem CID 136842706) has the molecular formula C19H15N5OS2 and a molecular weight of 393.50 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136842706 |
| Molecular Formula | C19H15N5OS2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C\c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C19H15N5OS2/c25-17(12-26-19-22-15-8-4-5-9-16(15)27-19)23-20-10-14-11-21-24-18(14)13-6-2-1-3-7-13/h1-11H,12H2,(H,21,24)(H,23,25)/b20-10- |
| InChIKey | SGKLPEIUZFXMIT-JMIUGGIZSA-N |
| XLogP | 3.93 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|