C20H14N4O4S2 — CID 6196621
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 6196621) has the molecular formula C20H14N4O4S2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6196621 |
| Molecular Formula | C20H14N4O4S2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C\c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C20H14N4O4S2/c25-19(12-29-20-22-16-6-1-2-7-18(16)30-20)23-21-11-15-8-9-17(28-15)13-4-3-5-14(10-13)24(26)27/h1-11H,12H2,(H,23,25)/b21-11- |
| InChIKey | KKMBOPTVJLOXAX-NHDPSOOVSA-N |
| XLogP | 4.71 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|