C21H14N4O2S2 — CID 3271810
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[5-(4-cyanophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 3271810) has the molecular formula C21H14N4O2S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[5-(4-cyanophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[5-(4-cyanophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3271810 |
| Molecular Formula | C21H14N4O2S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[5-(4-cyanophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | N#Cc1ccc(-c2ccc(C=NNC(=O)CSc3nc4ccccc4s3)o2)cc1 |
| InChI | InChI=1S/C21H14N4O2S2/c22-11-14-5-7-15(8-6-14)18-10-9-16(27-18)12-23-25-20(26)13-28-21-24-17-3-1-2-4-19(17)29-21/h1-10,12H,13H2,(H,25,26) |
| InChIKey | ROVJMDCHHSVGKU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|