C19H12N4O4S2 — CID 46502215
N-[(E)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide (PubChem CID 46502215) has the molecular formula C19H12N4O4S2 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[(E)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 46502215 |
| Molecular Formula | C19H12N4O4S2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-[(E)-[5-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2nc3ccc([N+](=O)[O-])cc3s2)o1)c1ccccc1 |
| InChI | InChI=1S/C19H12N4O4S2/c24-18(12-4-2-1-3-5-12)22-20-11-14-7-9-17(27-14)29-19-21-15-8-6-13(23(25)26)10-16(15)28-19/h1-11H,(H,22,24)/b20-11+ |
| InChIKey | MDZOBBHLBJMRLI-RGVLZGJSSA-N |
| XLogP | 4.71 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|