C19H12N4O4S — CID 9014926
N-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-nitrobenzamide (PubChem CID 9014926) has the molecular formula C19H12N4O4S and a molecular weight of 392.40 g/mol. Its IUPAC name is N-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9014926 |
| Molecular Formula | C19H12N4O4S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[(Z)-[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(N/N=C\c1ccc(-c2nc3ccccc3s2)o1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H12N4O4S/c24-18(12-5-7-13(8-6-12)23(25)26)22-20-11-14-9-10-16(27-14)19-21-15-3-1-2-4-17(15)28-19/h1-11H,(H,22,24)/b20-11- |
| InChIKey | MEGQQUYLIPCRHU-JAIQZWGSSA-N |
| XLogP | 4.23 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|