C26H19N5O4S — CID 4675457
4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 4675457) has the molecular formula C26H19N5O4S and a molecular weight of 497.54 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4675457 |
| Molecular Formula | C26H19N5O4S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1)c1ccc(CSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C26H19N5O4S/c32-25(30-27-15-21-13-14-24(35-21)18-9-11-20(12-10-18)31(33)34)19-7-5-17(6-8-19)16-36-26-28-22-3-1-2-4-23(22)29-26/h1-15H,16H2,(H,28,29)(H,30,32) |
| InChIKey | VDZNNXZCOZMGGQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|