C28H18N4O5S2 — CID 124529566
N-[(Z)-[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylideneamino]-4-methoxybenzamide (PubChem CID 124529566) has the molecular formula C28H18N4O5S2 and a molecular weight of 554.61 g/mol. Its IUPAC name is N-[(Z)-[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(Z)-[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 124529566 |
| Molecular Formula | C28H18N4O5S2 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | N-[(Z)-[5-[[6-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]furan-2-yl]methylideneamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(Sc3nc4ccc(N5C(=O)c6ccccc6C5=O)cc4s3)o2)cc1 |
| InChI | InChI=1S/C28H18N4O5S2/c1-36-18-9-6-16(7-10-18)25(33)31-29-15-19-11-13-24(37-19)39-28-30-22-12-8-17(14-23(22)38-28)32-26(34)20-4-2-3-5-21(20)27(32)35/h2-15H,1H3,(H,31,33)/b29-15- |
| InChIKey | WQNBWIOSUFIXLH-FDVSRXAVSA-N |
| XLogP | 5.61 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|