C20H23N3O2S2 — CID 6020464
N-[(Z)-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]octanamide (PubChem CID 6020464) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[(Z)-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]octanamide.
| Compound Name | N-[(Z)-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]octanamide |
|---|---|
| PubChem CID | 6020464 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[(Z)-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]methylideneamino]octanamide |
| SMILES | CCCCCCCC(=O)N/N=C\c1ccc(Sc2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C20H23N3O2S2/c1-2-3-4-5-6-11-18(24)23-21-14-15-12-13-19(25-15)27-20-22-16-9-7-8-10-17(16)26-20/h7-10,12-14H,2-6,11H2,1H3,(H,23,24)/b21-14- |
| InChIKey | SAZTUMCBCAGWQO-STZFKDTASA-N |
| XLogP | 5.85 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|