C14H9N5OS2 — CID 5390829
(Z)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5390829) has the molecular formula C14H9N5OS2 and a molecular weight of 327.39 g/mol. Its IUPAC name is (Z)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5390829 |
| Molecular Formula | C14H9N5OS2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (Z)-1-[5-(1,3-benzothiazol-2-ylsulfanyl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | C(=N\n1cnnc1)\c1ccc(Sc2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C14H9N5OS2/c1-2-4-12-11(3-1)18-14(21-12)22-13-6-5-10(20-13)7-17-19-8-15-16-9-19/h1-9H/b17-7- |
| InChIKey | BDEBHVMEUOILNX-IDUWFGFVSA-N |
| XLogP | 3.51 |
| TPSA | 69.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|