C18H12ClN3OS2 — CID 73462772
N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 73462772) has the molecular formula C18H12ClN3OS2 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 73462772 |
| Molecular Formula | C18H12ClN3OS2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | N-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc(Sc2ccc(C=NNc3nc4ccccc4s3)o2)cc1 |
| InChI | InChI=1S/C18H12ClN3OS2/c19-12-5-8-14(9-6-12)24-17-10-7-13(23-17)11-20-22-18-21-15-3-1-2-4-16(15)25-18/h1-11H,(H,21,22) |
| InChIKey | DGAPPRLUJONEBV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|